C15H16FNO3 — CID 115587242
4-[(4-ethoxy-3-fluoroanilino)methyl]benzene-1,2-diol (PubChem CID 115587242) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-[(4-ethoxy-3-fluoroanilino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(4-ethoxy-3-fluoroanilino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 115587242 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[(4-ethoxy-3-fluoroanilino)methyl]benzene-1,2-diol |
| SMILES | CCOc1ccc(NCc2ccc(O)c(O)c2)cc1F |
| InChI | InChI=1S/C15H16FNO3/c1-2-20-15-6-4-11(8-12(15)16)17-9-10-3-5-13(18)14(19)7-10/h3-8,17-19H,2,9H2,1H3 |
| InChIKey | OEFCGJOXSMLLSV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|