C16H18FN3O — CID 115587245
4-[(4-ethoxy-3-fluoroanilino)methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 115587245) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-[(4-ethoxy-3-fluoroanilino)methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(4-ethoxy-3-fluoroanilino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 115587245 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-[(4-ethoxy-3-fluoroanilino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | CCOc1ccc(NCc2cc(C#N)n(C)c2C)cc1F |
| InChI | InChI=1S/C16H18FN3O/c1-4-21-16-6-5-13(8-15(16)17)19-10-12-7-14(9-18)20(3)11(12)2/h5-8,19H,4,10H2,1-3H3 |
| InChIKey | RJRFDFMEYGQZJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|