About N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride
N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride (PubChem CID 115587292) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride |
| PubChem CID | 115587292 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride |
| SMILES | CC(C)CNc1cccc2c1OCCO2.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-9(2)8-13-10-4-3-5-11-12(10)15-7-6-14-11;/h3-5,9,13H,6-8H2,1-2H3;1H |
| InChIKey | FUWLQZPPRPPVJA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The IUPAC name of N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride (CID 115587292) is N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride.
What is the SMILES notation for N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The canonical SMILES for N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride is CC(C)CNc1cccc2c1OCCO2.Cl.
What is the InChIKey of N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
The InChIKey is FUWLQZPPRPPVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.ClH/c1-9(2)8-13-10-4-3-5-11-12(10)15-7-6-14-11;/h3-5,9,13H,6-8H2,1-2H3;1H.
What are the key properties of N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride?
N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride has a molecular weight of 243.73 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxin-5-amine;hydrochloride is sourced from PubChem (CID 115587292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).