C10H14Br2N2O2 — CID 115587307
4,5-dibromo-2-(2-butoxyethyl)pyridazin-3-one (PubChem CID 115587307) has the molecular formula C10H14Br2N2O2 and a molecular weight of 354.04 g/mol. Its IUPAC name is 4,5-dibromo-2-(2-butoxyethyl)pyridazin-3-one.
| Compound Name | 4,5-dibromo-2-(2-butoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 115587307 |
| Molecular Formula | C10H14Br2N2O2 |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 4,5-dibromo-2-(2-butoxyethyl)pyridazin-3-one |
| SMILES | CCCCOCCn1ncc(Br)c(Br)c1=O |
| InChI | InChI=1S/C10H14Br2N2O2/c1-2-3-5-16-6-4-14-10(15)9(12)8(11)7-13-14/h7H,2-6H2,1H3 |
| InChIKey | KEMQHBFJAPNNHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|