C14H29N3OS — CID 115587709
1-(3-ethoxypropyl)-3-(2-methyl-3-pyrrolidin-1-ylpropyl)thiourea (PubChem CID 115587709) has the molecular formula C14H29N3OS and a molecular weight of 287.47 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(2-methyl-3-pyrrolidin-1-ylpropyl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(2-methyl-3-pyrrolidin-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 115587709 |
| Molecular Formula | C14H29N3OS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(2-methyl-3-pyrrolidin-1-ylpropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCC(C)CN1CCCC1 |
| InChI | InChI=1S/C14H29N3OS/c1-3-18-10-6-7-15-14(19)16-11-13(2)12-17-8-4-5-9-17/h13H,3-12H2,1-2H3,(H2,15,16,19) |
| InChIKey | LZAZULXZZVEDBN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|