C12H26N2O3S — CID 115587999
1-(2-methoxyethyl)-1,3-bis(3-methoxypropyl)thiourea (PubChem CID 115587999) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1,3-bis(3-methoxypropyl)thiourea.
| Compound Name | 1-(2-methoxyethyl)-1,3-bis(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 115587999 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-(2-methoxyethyl)-1,3-bis(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N(CCCOC)CCOC |
| InChI | InChI=1S/C12H26N2O3S/c1-15-9-4-6-13-12(18)14(8-11-17-3)7-5-10-16-2/h4-11H2,1-3H3,(H,13,18) |
| InChIKey | FRHAYWAOAMGGHE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|