C16H19NO4S — CID 11558807
methyl (2S,6R)-6-ethenyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 11558807) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is methyl (2S,6R)-6-ethenyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | methyl (2S,6R)-6-ethenyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11558807 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methyl (2S,6R)-6-ethenyl-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | C=C[C@@H]1C=CC[C@@H](C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-4-13-6-5-7-15(16(18)21-3)17(13)22(19,20)14-10-8-12(2)9-11-14/h4-6,8-11,13,15H,1,7H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | VPYZOQNZWWDTOU-HIFRSBDPSA-N |
| XLogP | 2.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|