C12H14BrF3N2O2 — CID 115588198
2-(5-bromo-2-methoxyanilino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 115588198) has the molecular formula C12H14BrF3N2O2 and a molecular weight of 355.15 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyanilino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(5-bromo-2-methoxyanilino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 115588198 |
| Molecular Formula | C12H14BrF3N2O2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-(5-bromo-2-methoxyanilino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | COc1ccc(Br)cc1NC(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O2/c1-7(11(19)17-6-12(14,15)16)18-9-5-8(13)3-4-10(9)20-2/h3-5,7,18H,6H2,1-2H3,(H,17,19) |
| InChIKey | BDLGSNXWBNAAHS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |