C8H16N2O2 — CID 115588448
1-methyl-3-(oxan-3-ylmethyl)urea (PubChem CID 115588448) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-methyl-3-(oxan-3-ylmethyl)urea.
| Compound Name | 1-methyl-3-(oxan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 115588448 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 1-methyl-3-(oxan-3-ylmethyl)urea |
| SMILES | CNC(=O)NCC1CCCOC1 |
| InChI | InChI=1S/C8H16N2O2/c1-9-8(11)10-5-7-3-2-4-12-6-7/h7H,2-6H2,1H3,(H2,9,10,11) |
| InChIKey | PWFWZDUTKKCUGX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |