C15H20F2N2O2 — CID 115588993
2-[1-(2,6-difluorophenyl)ethylamino]-1-morpholin-4-ylpropan-1-one (PubChem CID 115588993) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)ethylamino]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-[1-(2,6-difluorophenyl)ethylamino]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 115588993 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)ethylamino]-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(NC(C)c1c(F)cccc1F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-10(14-12(16)4-3-5-13(14)17)18-11(2)15(20)19-6-8-21-9-7-19/h3-5,10-11,18H,6-9H2,1-2H3 |
| InChIKey | QERXWSIPKQVSDU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |