C18H18FN3O2 — CID 11558926
1-[(4-fluorophenyl)methyl]-N-hydroxy-N-propylpyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 11558926) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-hydroxy-N-propylpyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-hydroxy-N-propylpyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11558926 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-hydroxy-N-propylpyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CCCN(O)C(=O)c1cc2ccn(Cc3ccc(F)cc3)c2cn1 |
| InChI | InChI=1S/C18H18FN3O2/c1-2-8-22(24)18(23)16-10-14-7-9-21(17(14)11-20-16)12-13-3-5-15(19)6-4-13/h3-7,9-11,24H,2,8,12H2,1H3 |
| InChIKey | DDPNLUCBQHSHLI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|