C17H33NO3Si — CID 11558938
[(3aR,9S,9aS,9bS)-2,2-dimethyl-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11558938) has the molecular formula C17H33NO3Si and a molecular weight of 327.54 g/mol. Its IUPAC name is [(3aR,9S,9aS,9bS)-2,2-dimethyl-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,9S,9aS,9bS)-2,2-dimethyl-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11558938 |
| Molecular Formula | C17H33NO3Si |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | [(3aR,9S,9aS,9bS)-2,2-dimethyl-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizin-9-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCCN3C[C@H]2O1 |
| InChI | InChI=1S/C17H33NO3Si/c1-16(2,3)22(6,7)21-12-9-8-10-18-11-13-15(14(12)18)20-17(4,5)19-13/h12-15H,8-11H2,1-7H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | KPEORUGPQOSWKR-GBJTYRQASA-N |
| XLogP | 3.37 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|