C15H24O6Si — CID 11558955
[(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate (PubChem CID 11558955) has the molecular formula C15H24O6Si and a molecular weight of 328.44 g/mol. Its IUPAC name is [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate.
| Compound Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
|---|---|
| PubChem CID | 11558955 |
| Molecular Formula | C15H24O6Si |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(1R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dioxo-6-oxabicyclo[3.2.1]octan-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@@H](OC1=O)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C15H24O6Si/c1-9(16)20-15-7-10(19-13(15)18)12(17)11(8-15)21-22(5,6)14(2,3)4/h10-11H,7-8H2,1-6H3/t10-,11-,15-/m1/s1 |
| InChIKey | GRVQVONDDBHRPF-UEKVPHQBSA-N |
| XLogP | 1.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|