C17H17ClN4O — CID 11558965
5-[3-(4-chlorophenyl)propoxy]quinazoline-2,4-diamine (PubChem CID 11558965) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)propoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[3-(4-chlorophenyl)propoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 11558965 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-[3-(4-chlorophenyl)propoxy]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(OCCCc3ccc(Cl)cc3)cccc2n1 |
| InChI | InChI=1S/C17H17ClN4O/c18-12-8-6-11(7-9-12)3-2-10-23-14-5-1-4-13-15(14)16(19)22-17(20)21-13/h1,4-9H,2-3,10H2,(H4,19,20,21,22) |
| InChIKey | GFBDNLDKGXLJCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|