C13H20N2O4S — CID 115590077
N-[2-(2-methylpropoxy)ethyl]-4-sulfamoylbenzamide (PubChem CID 115590077) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(2-methylpropoxy)ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[2-(2-methylpropoxy)ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115590077 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[2-(2-methylpropoxy)ethyl]-4-sulfamoylbenzamide |
| SMILES | CC(C)COCCNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-10(2)9-19-8-7-15-13(16)11-3-5-12(6-4-11)20(14,17)18/h3-6,10H,7-9H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | JBSVINIJWBGDEH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|