C20H30O4 — CID 11559066
(2S,4Z)-2-[(1E,3R,4R,6Z,9Z)-3,4-dihydroxydodeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 11559066) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,4Z)-2-[(1E,3R,4R,6Z,9Z)-3,4-dihydroxydodeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-[(1E,3R,4R,6Z,9Z)-3,4-dihydroxydodeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 11559066 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S,4Z)-2-[(1E,3R,4R,6Z,9Z)-3,4-dihydroxydodeca-1,6,9-trienyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CC/C=C\C/C=C\C[C@@H](O)[C@H](O)/C=C/[C@@H]1C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-10-13-18(21)19(22)16-15-17-12-9-7-8-11-14-20(23)24-17/h3-4,6-7,9-10,15-19,21-22H,2,5,8,11-14H2,1H3/b4-3-,9-7-,10-6-,16-15+/t17-,18+,19+/m0/s1 |
| InChIKey | OIBRTSVGCWTYLU-TUDZHGKTSA-N |
| XLogP | 3.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|