About N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride (PubChem CID 115592208) has the molecular formula C12H16ClN3S
and a molecular weight of 269.80 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride |
| PubChem CID | 115592208 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride |
| SMILES | CCc1nc(CNc2ccc(C)cn2)cs1.Cl |
| InChI | InChI=1S/C12H15N3S.ClH/c1-3-12-15-10(8-16-12)7-14-11-5-4-9(2)6-13-11;/h4-6,8H,3,7H2,1-2H3,(H,13,14);1H |
| InChIKey | VAZQNFIQPCGCBG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride?
The IUPAC name of N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride (CID 115592208) is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride.
What is the SMILES notation for N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride?
The canonical SMILES for N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride is CCc1nc(CNc2ccc(C)cn2)cs1.Cl.
What is the InChIKey of N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride?
The InChIKey is VAZQNFIQPCGCBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S.ClH/c1-3-12-15-10(8-16-12)7-14-11-5-4-9(2)6-13-11;/h4-6,8H,3,7H2,1-2H3,(H,13,14);1H.
What are the key properties of N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride?
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride has a molecular weight of 269.80 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-5-methylpyridin-2-amine;hydrochloride is sourced from PubChem (CID 115592208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).