About 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride
3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride (PubChem CID 115592466) has the molecular formula C8H10Cl2F3NO2
and a molecular weight of 280.07 g/mol. Its IUPAC name is 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride |
| PubChem CID | 115592466 |
| Molecular Formula | C8H10Cl2F3NO2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride |
| SMILES | Cl.OC(CNCc1ccc(Cl)o1)C(F)(F)F |
| InChI | InChI=1S/C8H9ClF3NO2.ClH/c9-7-2-1-5(15-7)3-13-4-6(14)8(10,11)12;/h1-2,6,13-14H,3-4H2;1H |
| InChIKey | NSFASJLKEHXOQV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride?
The IUPAC name of 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride (CID 115592466) is 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride.
What is the SMILES notation for 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride?
The canonical SMILES for 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride is Cl.OC(CNCc1ccc(Cl)o1)C(F)(F)F.
What is the InChIKey of 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride?
The InChIKey is NSFASJLKEHXOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3NO2.ClH/c9-7-2-1-5(15-7)3-13-4-6(14)8(10,11)12;/h1-2,6,13-14H,3-4H2;1H.
What are the key properties of 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride?
3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride has a molecular weight of 280.07 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chlorofuran-2-yl)methylamino]-1,1,1-trifluoropropan-2-ol;hydrochloride is sourced from PubChem (CID 115592466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).