C23H39NO — CID 11559278
3-[(2R,4R,5R)-1-heptyl-4,5-dimethyl-2-propylpiperidin-4-yl]phenol (PubChem CID 11559278) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-1-heptyl-4,5-dimethyl-2-propylpiperidin-4-yl]phenol.
| Compound Name | 3-[(2R,4R,5R)-1-heptyl-4,5-dimethyl-2-propylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 11559278 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 3-[(2R,4R,5R)-1-heptyl-4,5-dimethyl-2-propylpiperidin-4-yl]phenol |
| SMILES | CCCCCCCN1C[C@H](C)[C@](C)(c2cccc(O)c2)C[C@H]1CCC |
| InChI | InChI=1S/C23H39NO/c1-5-7-8-9-10-15-24-18-19(3)23(4,17-21(24)12-6-2)20-13-11-14-22(25)16-20/h11,13-14,16,19,21,25H,5-10,12,15,17-18H2,1-4H3/t19-,21+,23+/m0/s1 |
| InChIKey | LITCAKDCGXFMNT-XKCSPQBFSA-N |
| XLogP | 6.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|