About 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea
1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115592917) has the molecular formula C9H15F3N2O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 115592917 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(CC1CCCO1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2/c1-14(5-7-3-2-4-16-7)8(15)13-6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | SUCJBJBFNCCCKQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea (CID 115592917) is 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea is CN(CC1CCCO1)C(=O)NCC(F)(F)F.
What is the InChIKey of 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is SUCJBJBFNCCCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2/c1-14(5-7-3-2-4-16-7)8(15)13-6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15).
What are the key properties of 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea?
1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 240.22 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-(oxolan-2-ylmethyl)-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 115592917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).