C15H18ClN3OS — CID 115593045
2-[(4-chlorophenyl)methylsulfanyl]-N-(5-propan-2-yl-1H-pyrazol-3-yl)acetamide (PubChem CID 115593045) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-(5-propan-2-yl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(5-propan-2-yl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 115593045 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(5-propan-2-yl-1H-pyrazol-3-yl)acetamide |
| SMILES | CC(C)c1cc(NC(=O)CSCc2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-10(2)13-7-14(19-18-13)17-15(20)9-21-8-11-3-5-12(16)6-4-11/h3-7,10H,8-9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | LGJCZNGJRNDUIC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |