C11H18Cl2N2O — CID 115593264
N-[(5-chlorofuran-2-yl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine;hydrochloride (PubChem CID 115593264) has the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. Its IUPAC name is N-[(5-chlorofuran-2-yl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine;hydrochloride.
| Compound Name | N-[(5-chlorofuran-2-yl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115593264 |
| Molecular Formula | C11H18Cl2N2O |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[(5-chlorofuran-2-yl)methyl]-1-(1-methylpyrrolidin-2-yl)methanamine;hydrochloride |
| SMILES | CN1CCCC1CNCc1ccc(Cl)o1.Cl |
| InChI | InChI=1S/C11H17ClN2O.ClH/c1-14-6-2-3-9(14)7-13-8-10-4-5-11(12)15-10;/h4-5,9,13H,2-3,6-8H2,1H3;1H |
| InChIKey | WDYIICXDMIYNJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |