C21H20N2O3 — CID 11559328
2-(2-benzoyl-6-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)acetic acid (PubChem CID 11559328) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(2-benzoyl-6-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)acetic acid.
| Compound Name | 2-(2-benzoyl-6-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)acetic acid |
|---|---|
| PubChem CID | 11559328 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(2-benzoyl-6-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)acetic acid |
| SMILES | Cc1cccc2c3c(n(CC(=O)O)c12)CCN(C(=O)c1ccccc1)C3 |
| InChI | InChI=1S/C21H20N2O3/c1-14-6-5-9-16-17-12-22(21(26)15-7-3-2-4-8-15)11-10-18(17)23(20(14)16)13-19(24)25/h2-9H,10-13H2,1H3,(H,24,25) |
| InChIKey | LWSSNAISVQXGSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|