C10H20N2O — CID 115593303
N,N-dimethyl-2-propan-2-ylpyrrolidine-1-carboxamide (PubChem CID 115593303) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N,N-dimethyl-2-propan-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N,N-dimethyl-2-propan-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 115593303 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N,N-dimethyl-2-propan-2-ylpyrrolidine-1-carboxamide |
| SMILES | CC(C)C1CCCN1C(=O)N(C)C |
| InChI | InChI=1S/C10H20N2O/c1-8(2)9-6-5-7-12(9)10(13)11(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | KICIGWRYHRVERN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |