C10H12F3N3O — CID 115593407
N-cyclopropyl-N-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 115593407) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-cyclopropyl-N-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 115593407 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-cyclopropyl-N-methyl-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CN(C(=O)Cn1ccc(C(F)(F)F)n1)C1CC1 |
| InChI | InChI=1S/C10H12F3N3O/c1-15(7-2-3-7)9(17)6-16-5-4-8(14-16)10(11,12)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | NMZOZLCSOVUKRI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |