About N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide
N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 115593805) has the molecular formula C13H13N5O2
and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide |
| PubChem CID | 115593805 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | CCc1cc(NC(=O)c2cnc3onc(C)c3c2)n[nH]1 |
| InChI | InChI=1S/C13H13N5O2/c1-3-9-5-11(17-16-9)15-12(19)8-4-10-7(2)18-20-13(10)14-6-8/h4-6H,3H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | DWOVLCBVPGJWFC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide?
The IUPAC name of N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide (CID 115593805) is N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide.
What is the SMILES notation for N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide?
The canonical SMILES for N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide is CCc1cc(NC(=O)c2cnc3onc(C)c3c2)n[nH]1.
What is the InChIKey of N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide?
The InChIKey is DWOVLCBVPGJWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O2/c1-3-9-5-11(17-16-9)15-12(19)8-4-10-7(2)18-20-13(10)14-6-8/h4-6H,3H2,1-2H3,(H2,15,16,17,19).
What are the key properties of N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide?
N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide has a molecular weight of 271.28 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-1H-pyrazol-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide is sourced from PubChem (CID 115593805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).