About piperidin-4-yl 2,2-diphenyl-2-propoxyacetate
piperidin-4-yl 2,2-diphenyl-2-propoxyacetate (PubChem CID 11559429) has the molecular formula C22H27NO3
and a molecular weight of 353.46 g/mol. Its IUPAC name is piperidin-4-yl 2,2-diphenyl-2-propoxyacetate.
Molecular Properties
| Compound Name | piperidin-4-yl 2,2-diphenyl-2-propoxyacetate |
| PubChem CID | 11559429 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | piperidin-4-yl 2,2-diphenyl-2-propoxyacetate |
| SMILES | CCCOC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3 |
| InChIKey | FMRVAGKPRZLTRG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-yl 2,2-diphenyl-2-propoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The IUPAC name of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate (CID 11559429) is piperidin-4-yl 2,2-diphenyl-2-propoxyacetate.
What is the SMILES notation for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The canonical SMILES for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate is CCCOC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The InChIKey is FMRVAGKPRZLTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3.
What are the key properties of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
piperidin-4-yl 2,2-diphenyl-2-propoxyacetate has a molecular weight of 353.46 g/mol, XLogP of 3.65, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate is sourced from PubChem (CID 11559429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).