piperidin-4-yl 2,2-diphenyl-2-propoxyacetate

C22H27NO3 — CID 11559429

IUPACpiperidin-4-yl 2,2-diphenyl-2-propoxyacetate
SMILESCCCOC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1
InChIInChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3
InChIKeyFMRVAGKPRZLTRG-UHFFFAOYSA-N
MW353.46 g/mol
LogP3.65
Rot. Bonds7

About piperidin-4-yl 2,2-diphenyl-2-propoxyacetate

piperidin-4-yl 2,2-diphenyl-2-propoxyacetate (PubChem CID 11559429) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is piperidin-4-yl 2,2-diphenyl-2-propoxyacetate.

Molecular Properties

Compound Namepiperidin-4-yl 2,2-diphenyl-2-propoxyacetate
PubChem CID11559429
Molecular FormulaC22H27NO3
Molecular Weight353.46 g/mol
Exact Mass353.20
IUPAC Namepiperidin-4-yl 2,2-diphenyl-2-propoxyacetate
SMILESCCCOC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1
InChIInChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3
InChIKeyFMRVAGKPRZLTRG-UHFFFAOYSA-N
XLogP3.65
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.46
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze piperidin-4-yl 2,2-diphenyl-2-propoxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The IUPAC name of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate (CID 11559429) is piperidin-4-yl 2,2-diphenyl-2-propoxyacetate.
What is the SMILES notation for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The canonical SMILES for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate is CCCOC(C(=O)OC1CCNCC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
The InChIKey is FMRVAGKPRZLTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-2-17-25-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)26-20-13-15-23-16-14-20/h3-12,20,23H,2,13-17H2,1H3.
What are the key properties of piperidin-4-yl 2,2-diphenyl-2-propoxyacetate?
piperidin-4-yl 2,2-diphenyl-2-propoxyacetate has a molecular weight of 353.46 g/mol, XLogP of 3.65, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 2,2-diphenyl-2-propoxyacetate is sourced from PubChem (CID 11559429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).