C24H40N2 — CID 11559491
(2E)-2-[1-(3,4-dimethyl-1H-pyrrol-2-yl)undecylidene]-4,4,5-trimethyl-3H-pyrrole (PubChem CID 11559491) has the molecular formula C24H40N2 and a molecular weight of 356.60 g/mol. Its IUPAC name is (2E)-2-[1-(3,4-dimethyl-1H-pyrrol-2-yl)undecylidene]-4,4,5-trimethyl-3H-pyrrole.
| Compound Name | (2E)-2-[1-(3,4-dimethyl-1H-pyrrol-2-yl)undecylidene]-4,4,5-trimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 11559491 |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | (2E)-2-[1-(3,4-dimethyl-1H-pyrrol-2-yl)undecylidene]-4,4,5-trimethyl-3H-pyrrole |
| SMILES | CCCCCCCCCC/C(=C1/CC(C)(C)C(C)=N1)c1[nH]cc(C)c1C |
| InChI | InChI=1S/C24H40N2/c1-7-8-9-10-11-12-13-14-15-21(23-19(3)18(2)17-25-23)22-16-24(5,6)20(4)26-22/h17,25H,7-16H2,1-6H3/b22-21+ |
| InChIKey | HCKCOKVLJIMIKE-QURGRASLSA-N |
| XLogP | 7.76 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|