C19H14F3NOS — CID 11559567
2,2,2-trifluoro-1-(10-methyl-12-phenyl-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl)ethanone (PubChem CID 11559567) has the molecular formula C19H14F3NOS and a molecular weight of 361.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(10-methyl-12-phenyl-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(10-methyl-12-phenyl-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 11559567 |
| Molecular Formula | C19H14F3NOS |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(10-methyl-12-phenyl-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl)ethanone |
| SMILES | Cc1nc2sc3c(c2c(-c2ccccc2)c1C(=O)C(F)(F)F)CCC3 |
| InChI | InChI=1S/C19H14F3NOS/c1-10-14(17(24)19(20,21)22)15(11-6-3-2-4-7-11)16-12-8-5-9-13(12)25-18(16)23-10/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | AJADIVZCNCJCQI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |