C21H17NO5 — CID 11559597
(3aS,4S,7R,7aR)-5,6-bis(4-hydroxyphenyl)-2-methyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 11559597) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-5,6-bis(4-hydroxyphenyl)-2-methyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,7R,7aR)-5,6-bis(4-hydroxyphenyl)-2-methyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11559597 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3aS,4S,7R,7aR)-5,6-bis(4-hydroxyphenyl)-2-methyl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1O[C@H]2C(c2ccc(O)cc2)=C1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H17NO5/c1-22-20(25)16-17(21(22)26)19-15(11-4-8-13(24)9-5-11)14(18(16)27-19)10-2-6-12(23)7-3-10/h2-9,16-19,23-24H,1H3/t16-,17+,18+,19- |
| InChIKey | QMSLDDDUADQJHZ-SEXKYXSUSA-N |
| XLogP | 2.02 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|