About but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate
but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate (PubChem CID 11559633) has the molecular formula C21H36O3Si
and a molecular weight of 364.60 g/mol. Its IUPAC name is but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate.
Molecular Properties
| Compound Name | but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate |
| PubChem CID | 11559633 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate |
| SMILES | C=CC(C)OC(=O)C(=C)CCCCCC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-9-19(3)24-20(22)18(2)16-14-12-10-11-13-15-17-23-25(7,8)21(4,5)6/h9,19H,1-2,10-12,14,16-17H2,3-8H3 |
| InChIKey | QXIVZULNRRUEPT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate?
The IUPAC name of but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate (CID 11559633) is but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate.
What is the SMILES notation for but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate?
The canonical SMILES for but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate is C=CC(C)OC(=O)C(=C)CCCCCC#CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate?
The InChIKey is QXIVZULNRRUEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O3Si/c1-9-19(3)24-20(22)18(2)16-14-12-10-11-13-15-17-23-25(7,8)21(4,5)6/h9,19H,1-2,10-12,14,16-17H2,3-8H3.
What are the key properties of but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate?
but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate has a molecular weight of 364.60 g/mol, XLogP of 5.64, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yl 10-[tert-butyl(dimethyl)silyl]oxy-2-methylidenedec-8-ynoate is sourced from PubChem (CID 11559633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).