C13H15N3O5 — CID 115596375
2-[1-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 115596375) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-[1-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 115596375 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[1-(6-methyl-2-oxo-1H-pyridine-3-carbonyl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | Cc1ccc(C(=O)N2CCNC(=O)C2CC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O5/c1-7-2-3-8(11(19)15-7)13(21)16-5-4-14-12(20)9(16)6-10(17)18/h2-3,9H,4-6H2,1H3,(H,14,20)(H,15,19)(H,17,18) |
| InChIKey | IJABBPUMYXNYML-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |