C20H35NO3Si — CID 11559649
N-benzyl-1-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (PubChem CID 11559649) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is N-benzyl-1-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
| Compound Name | N-benzyl-1-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
|---|---|
| PubChem CID | 11559649 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N-benzyl-1-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| SMILES | CC1(C)O[C@@H](CNCc2ccccc2)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H35NO3Si/c1-19(2,3)25(6,7)22-15-18-17(23-20(4,5)24-18)14-21-13-16-11-9-8-10-12-16/h8-12,17-18,21H,13-15H2,1-7H3/t17-,18+/m0/s1 |
| InChIKey | QFVUKNYJJQEXNB-ZWKOTPCHSA-N |
| XLogP | 4.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|