C14H14N4O3 — CID 115597400
4-amino-N-[2-[(3-hydroxy-2-pyridinyl)amino]-2-oxoethyl]benzamide (PubChem CID 115597400) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-amino-N-[2-[(3-hydroxy-2-pyridinyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-[(3-hydroxy-2-pyridinyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 115597400 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-N-[2-[(3-hydroxy-2-pyridinyl)amino]-2-oxoethyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCC(=O)Nc2ncccc2O)cc1 |
| InChI | InChI=1S/C14H14N4O3/c15-10-5-3-9(4-6-10)14(21)17-8-12(20)18-13-11(19)2-1-7-16-13/h1-7,19H,8,15H2,(H,17,21)(H,16,18,20) |
| InChIKey | VQKOHKIJGDJVDV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|