About (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide
(E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide (PubChem CID 11559820) has the molecular formula C25H30N2O
and a molecular weight of 374.53 g/mol. Its IUPAC name is (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide |
| PubChem CID | 11559820 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCN1CCC2(CCc3ccccc32)CC1 |
| InChI | InChI=1S/C25H30N2O/c28-24(12-11-21-7-2-1-3-8-21)26-17-6-18-27-19-15-25(16-20-27)14-13-22-9-4-5-10-23(22)25/h1-5,7-12H,6,13-20H2,(H,26,28)/b12-11+ |
| InChIKey | QITHKMFBAHBZTH-VAWYXSNFSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide?
The IUPAC name of (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide (CID 11559820) is (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide.
What is the SMILES notation for (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide?
The canonical SMILES for (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide is O=C(/C=C/c1ccccc1)NCCCN1CCC2(CCc3ccccc32)CC1.
What is the InChIKey of (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide?
The InChIKey is QITHKMFBAHBZTH-VAWYXSNFSA-N. The full InChI is InChI=1S/C25H30N2O/c28-24(12-11-21-7-2-1-3-8-21)26-17-6-18-27-19-15-25(16-20-27)14-13-22-9-4-5-10-23(22)25/h1-5,7-12H,6,13-20H2,(H,26,28)/b12-11+.
What are the key properties of (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide?
(E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide has a molecular weight of 374.53 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-phenyl-N-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)prop-2-enamide is sourced from PubChem (CID 11559820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).