C21H23F3N2O — CID 11559847
10-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)phenoxazine (PubChem CID 11559847) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 10-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)phenoxazine.
| Compound Name | 10-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)phenoxazine |
|---|---|
| PubChem CID | 11559847 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 10-(4-pyrrolidin-1-ylbutyl)-2-(trifluoromethyl)phenoxazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCCN1CCCC1)c1ccccc1O2 |
| InChI | InChI=1S/C21H23F3N2O/c22-21(23,24)16-9-10-20-18(15-16)26(17-7-1-2-8-19(17)27-20)14-6-5-13-25-11-3-4-12-25/h1-2,7-10,15H,3-6,11-14H2 |
| InChIKey | LCLSPOMMANOILP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|