C12H14N4O3 — CID 115598698
6-[(2-hydroxyphenyl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 115598698) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 6-[(2-hydroxyphenyl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2-hydroxyphenyl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 115598698 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 6-[(2-hydroxyphenyl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NCc2ccccc2O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H14N4O3/c1-15-11(18)10(14-16(2)12(15)19)13-7-8-5-3-4-6-9(8)17/h3-6,17H,7H2,1-2H3,(H,13,14) |
| InChIKey | HYBKDVDYNWUEMI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|