C16H22ClNO2S — CID 115600164
N-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-(2-methoxyethoxy)butan-1-amine (PubChem CID 115600164) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is N-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-(2-methoxyethoxy)butan-1-amine.
| Compound Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-(2-methoxyethoxy)butan-1-amine |
|---|---|
| PubChem CID | 115600164 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-(2-methoxyethoxy)butan-1-amine |
| SMILES | COCCOCCCCNCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C16H22ClNO2S/c1-19-10-11-20-9-5-4-8-18-12-15-16(17)13-6-2-3-7-14(13)21-15/h2-3,6-7,18H,4-5,8-12H2,1H3 |
| InChIKey | UIVWSVVQARJDAK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|