About S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate
S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate (PubChem CID 11560055) has the molecular formula C18H28N2O3S2
and a molecular weight of 384.57 g/mol. Its IUPAC name is S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate.
Molecular Properties
| Compound Name | S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate |
| PubChem CID | 11560055 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCC(=O)Cc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-13(21)24-12-16(23)19-9-7-5-6-8-14(22)10-17-20-15(11-25-17)18(2,3)4/h11H,5-10,12H2,1-4H3,(H,19,23) |
| InChIKey | WRMMDSFKHHXKGG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate?
The IUPAC name of S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate (CID 11560055) is S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate.
What is the SMILES notation for S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate?
The canonical SMILES for S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate is CC(=O)SCC(=O)NCCCCCC(=O)Cc1nc(C(C)(C)C)cs1.
What is the InChIKey of S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate?
The InChIKey is WRMMDSFKHHXKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O3S2/c1-13(21)24-12-16(23)19-9-7-5-6-8-14(22)10-17-20-15(11-25-17)18(2,3)4/h11H,5-10,12H2,1-4H3,(H,19,23).
What are the key properties of S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate?
S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate has a molecular weight of 384.57 g/mol, XLogP of 3.51, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]amino]-2-oxoethyl] ethanethioate is sourced from PubChem (CID 11560055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).