C16H19NO6S2 — CID 11560069
1-(3,5-dimethoxyphenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 11560069) has the molecular formula C16H19NO6S2 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11560069 |
| Molecular Formula | C16H19NO6S2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C(SCCO)=C(SCCO)C2=O)c1 |
| InChI | InChI=1S/C16H19NO6S2/c1-22-11-7-10(8-12(9-11)23-2)17-15(20)13(24-5-3-18)14(16(17)21)25-6-4-19/h7-9,18-19H,3-6H2,1-2H3 |
| InChIKey | JZCVXVMPKFKSDS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|