C20H38N2O3S — CID 11560099
1-(6-hydroxy-4,4,5-trimethylhexyl)-3-[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea (PubChem CID 11560099) has the molecular formula C20H38N2O3S and a molecular weight of 386.60 g/mol. Its IUPAC name is 1-(6-hydroxy-4,4,5-trimethylhexyl)-3-[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea.
| Compound Name | 1-(6-hydroxy-4,4,5-trimethylhexyl)-3-[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea |
|---|---|
| PubChem CID | 11560099 |
| Molecular Formula | C20H38N2O3S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-(6-hydroxy-4,4,5-trimethylhexyl)-3-[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea |
| SMILES | CC(CO)C(C)(C)CCCNC(=S)NCCCC(C)(C)C1COC(=O)C1 |
| InChI | InChI=1S/C20H38N2O3S/c1-15(13-23)19(2,3)8-6-10-21-18(26)22-11-7-9-20(4,5)16-12-17(24)25-14-16/h15-16,23H,6-14H2,1-5H3,(H2,21,22,26) |
| InChIKey | RKXZUANYBBGKOE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|