C11H23N3S — CID 115602001
1-[(1-methylpiperidin-4-yl)methyl]-3-propylthiourea (PubChem CID 115602001) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is 1-[(1-methylpiperidin-4-yl)methyl]-3-propylthiourea.
| Compound Name | 1-[(1-methylpiperidin-4-yl)methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 115602001 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-[(1-methylpiperidin-4-yl)methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCC1CCN(C)CC1 |
| InChI | InChI=1S/C11H23N3S/c1-3-6-12-11(15)13-9-10-4-7-14(2)8-5-10/h10H,3-9H2,1-2H3,(H2,12,13,15) |
| InChIKey | GTNUAYVINLLWJN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|