C17H13N9O3 — CID 11560202
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-oxidopyridin-1-ium-3-yl)urea (PubChem CID 11560202) has the molecular formula C17H13N9O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-oxidopyridin-1-ium-3-yl)urea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-oxidopyridin-1-ium-3-yl)urea |
|---|---|
| PubChem CID | 11560202 |
| Molecular Formula | C17H13N9O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(1-oxidopyridin-1-ium-3-yl)urea |
| SMILES | Cn1cc2c(nc(NC(=O)Nc3ccc[n+]([O-])c3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C17H13N9O3/c1-24-9-11-13(22-24)20-16(21-17(27)18-10-4-2-6-25(28)8-10)26-15(11)19-14(23-26)12-5-3-7-29-12/h2-9H,1H3,(H2,18,20,21,22,27) |
| InChIKey | SRNYNTJDFPPRNN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|