C15H15N3O2S — CID 115602102
6-cyano-N-(2,4,6-trimethylphenyl)pyridine-3-sulfonamide (PubChem CID 115602102) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 6-cyano-N-(2,4,6-trimethylphenyl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(2,4,6-trimethylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115602102 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 6-cyano-N-(2,4,6-trimethylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(C#N)nc2)c(C)c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-10-6-11(2)15(12(3)7-10)18-21(19,20)14-5-4-13(8-16)17-9-14/h4-7,9,18H,1-3H3 |
| InChIKey | PLSDTBFHHZJVHN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |