C11H13N3O2S — CID 115602600
6-cyano-N-(cyclobutylmethyl)pyridine-3-sulfonamide (PubChem CID 115602600) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 6-cyano-N-(cyclobutylmethyl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(cyclobutylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115602600 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 6-cyano-N-(cyclobutylmethyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC2CCC2)cn1 |
| InChI | InChI=1S/C11H13N3O2S/c12-6-10-4-5-11(8-13-10)17(15,16)14-7-9-2-1-3-9/h4-5,8-9,14H,1-3,7H2 |
| InChIKey | TWTXZPLCUSTHAX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |