About 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine
1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 11560313) has the molecular formula C20H28N8O
and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 11560313 |
| Molecular Formula | C20H28N8O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CC)c2nc(N3CCNCC3)nc(Nc3ccccn3)c21 |
| InChI | InChI=1S/C20H28N8O/c1-3-15-17-18(28(26-15)13-14-29-4-2)19(23-16-7-5-6-8-22-16)25-20(24-17)27-11-9-21-10-12-27/h5-8,21H,3-4,9-14H2,1-2H3,(H,22,23,24,25) |
| InChIKey | GRYMXFLCUPGRFW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine (CID 11560313) is 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine is CCOCCn1nc(CC)c2nc(N3CCNCC3)nc(Nc3ccccn3)c21.
What is the InChIKey of 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is GRYMXFLCUPGRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N8O/c1-3-15-17-18(28(26-15)13-14-29-4-2)19(23-16-7-5-6-8-22-16)25-20(24-17)27-11-9-21-10-12-27/h5-8,21H,3-4,9-14H2,1-2H3,(H,22,23,24,25).
What are the key properties of 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine?
1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 396.50 g/mol, XLogP of 1.97, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxyethyl)-3-ethyl-5-piperazin-1-yl-N-pyridin-2-ylpyrazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 11560313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).