About 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine
4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine (PubChem CID 1156032) has the molecular formula C18H19N3O3S
and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine.
Molecular Properties
| Compound Name | 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine |
| PubChem CID | 1156032 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine |
| SMILES | Cc1cccn2cc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C18H19N3O3S/c1-14-3-2-8-20-13-17(19-18(14)20)15-4-6-16(7-5-15)25(22,23)21-9-11-24-12-10-21/h2-8,13H,9-12H2,1H3 |
| InChIKey | QGHGDBYUVUFFCW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine?
The IUPAC name of 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine (CID 1156032) is 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine.
What is the SMILES notation for 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine?
The canonical SMILES for 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine is Cc1cccn2cc(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)nc12.
What is the InChIKey of 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine?
The InChIKey is QGHGDBYUVUFFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3S/c1-14-3-2-8-20-13-17(19-18(14)20)15-4-6-16(7-5-15)25(22,23)21-9-11-24-12-10-21/h2-8,13H,9-12H2,1H3.
What are the key properties of 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine?
4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine has a molecular weight of 357.44 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]sulfonylmorpholine is sourced from PubChem (CID 1156032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).