About 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile
3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile (PubChem CID 115605234) has the molecular formula C13H16N6
and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile |
| PubChem CID | 115605234 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile |
| SMILES | Cc1cc(C)n(CCCNc2nccnc2C#N)n1 |
| InChI | InChI=1S/C13H16N6/c1-10-8-11(2)19(18-10)7-3-4-16-13-12(9-14)15-5-6-17-13/h5-6,8H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | OJEGRIVVENRAMN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile?
The IUPAC name of 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile (CID 115605234) is 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile is Cc1cc(C)n(CCCNc2nccnc2C#N)n1.
What is the InChIKey of 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile?
The InChIKey is OJEGRIVVENRAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N6/c1-10-8-11(2)19(18-10)7-3-4-16-13-12(9-14)15-5-6-17-13/h5-6,8H,3-4,7H2,1-2H3,(H,16,17).
What are the key properties of 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile?
3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile has a molecular weight of 256.31 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbonitrile is sourced from PubChem (CID 115605234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).