C15H24ClN — CID 115605434
3-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butan-1-amine;hydrochloride (PubChem CID 115605434) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is 3-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butan-1-amine;hydrochloride.
| Compound Name | 3-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 115605434 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]butan-1-amine;hydrochloride |
| SMILES | C/C(=C\c1ccccc1)CNCCC(C)C.Cl |
| InChI | InChI=1S/C15H23N.ClH/c1-13(2)9-10-16-12-14(3)11-15-7-5-4-6-8-15;/h4-8,11,13,16H,9-10,12H2,1-3H3;1H/b14-11+; |
| InChIKey | ITLMOVRNIZKFIV-JHGYPSGKSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|