C19H27N3O7 — CID 11560571
[(Z)-[(3R,4R,5S,6R)-3-(hexanoylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-ylidene]amino] N-phenylcarbamate (PubChem CID 11560571) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is [(Z)-[(3R,4R,5S,6R)-3-(hexanoylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-ylidene]amino] N-phenylcarbamate.
| Compound Name | [(Z)-[(3R,4R,5S,6R)-3-(hexanoylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-ylidene]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 11560571 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [(Z)-[(3R,4R,5S,6R)-3-(hexanoylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-ylidene]amino] N-phenylcarbamate |
| SMILES | CCCCCC(=O)N[C@H]1/C(=N/OC(=O)Nc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H27N3O7/c1-2-3-5-10-14(24)21-15-17(26)16(25)13(11-23)28-18(15)22-29-19(27)20-12-8-6-4-7-9-12/h4,6-9,13,15-17,23,25-26H,2-3,5,10-11H2,1H3,(H,20,27)(H,21,24)/b22-18-/t13-,15-,16-,17-/m1/s1 |
| InChIKey | VIUUSOMOWDCFGS-GQLDKMOOSA-N |
| XLogP | 0.73 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|